On Target AMPN_HUMAN 0.32456142/CHEMBL2204943
For the given ligand lvkui19001, we have found in our database that, being scored 0.32456142, the most similar ligand is CHEMBL2204943. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL2204943 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CC(C)C[C@H](NC(=O)Nc1cccc2ccccc12)C(=O)NO |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00010006 01003010 40100000 00000e00 00000000 00000000 04000004 00002021 00000000 000208c0 00280004 4001b000 0400b004 00100000 00000040 00000010 00040000 00400010 08000000 000c0001 40000100 38050608 20022000 00000018 00110000 00000000 00000000 10000080 08008000 00060005 20084000 00404200 |