On Target ADRB2_HUMAN 0.43410853/CHEMBL1083053
For the given ligand lvkui19001, we have found in our database that, being scored 0.43410853, the most similar ligand is CHEMBL1083053. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL1083053 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CC(C)c1ccccc1OCC(O)CN2CCN(CCN3C(=O)c4cccc5cccc(C3=O)c45)CC2 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 04000002 00000408 20104108 46010600 00041080 82000060 02000000 00000200 06200011 400808e0 0c200004 40018000 00808802 00602000 01300841 000c200c 10200000 22008000 00a00000 00020200 40000000 38008018 278000a3 8a700010 0c000001 c0000000 00000000 00800000 08000300 00060012 00040000 00000640 |