On Target PPARG_HUMAN 0.36144578/CHEMBL3959627
For the given ligand lvkui19001, we have found in our database that, being scored 0.36144578, the most similar ligand is CHEMBL3959627. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL3959627 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CCCCNC(=O)NS(=O)(=O)c1ccc(NC(=O)CN2C(=O)C(=Nc3ccccc23)C)cc1 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00004032 00803000 01100020 52b00e10 000c1072 00002100 08008006 00003008 16200001 00003ae0 0c282004 e001a400 00009800 01500041 80b608c0 0e040004 0a042000 c2000000 08600000 00006001 e0102080 38058610 21802000 0860001a 0c040000 40000000 88008000 100004cc 08008404 20060811 000c0000 00010260 |