On Target CASP1_HUMAN 0.3974359/CHEMBL308700
For the given ligand lvkui19001, we have found in our database that, being scored 0.3974359, the most similar ligand is CHEMBL308700. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL308700 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | C[C@H](N1C=CC=C(NC(=O)CCc2ccccc2)C1=O)C(=O)N[C@@H](CC(=O)O)C=O |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00044002 00801600 00104100 40010620 20040004 08002050 00000000 00000000 06200801 400808e0 0c38000c 4001b000 0e008802 00700001 80120981 040c000c 04040000 42000009 08e00018 00001207 c0100100 38108e10 21806081 0270001a 0c001803 c0100000 00000410 10000080 08000802 0046001b 20404000 00002688 |