On Target PPAP_HUMAN 0.1322314/CHEMBL68858
For the given ligand lvkui19001, we have found in our database that, being scored 0.1322314, the most similar ligand is CHEMBL68858. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL68858 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | OP(=O)(O)C(NCc1ccccc1)c2cccc3ccccc23 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00010010 00000600 00000100 00010600 00000000 00400000 04000000 02001000 000000c0 00000840 00200000 40008000 00000802 00020000 8008040c 00000000 00003028 02000000 00000000 00000200 00000000 0d308008 00000000 00400000 00000000 c6010006 00000000 80014000 00000100 30060000 00040000 00008203 |