On Target CHLE_HUMAN 0.41964287/CHEMBL488590
For the given ligand lvkui19001, we have found in our database that, being scored 0.41964287, the most similar ligand is CHEMBL488590. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL488590 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CCN(CCCCCCN1C(=O)c2cccc3cccc(C1=O)c23)Cc4ccccc4OC |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00000002 01000008 20104108 02010600 00041000 00000160 02000000 22001400 06000000 c01008e0 0c200004 40018000 00008802 00600000 01100441 0004200c 00000000 02000000 00202000 00020201 40000000 18008018 20800000 80700010 00000000 c0000000 00000000 90000000 00000300 00060000 24040000 00000200 |