On Target PDE4B_HUMAN 0.30379745/CHEMBL3644499
For the given ligand lvkui19001, we have found in our database that, being scored 0.30379745, the most similar ligand is CHEMBL3644499. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL3644499 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | COc1cccc2c3N(C4CCCC4)C(=O)N(C(=O)c3cnc12)c5cccc(C)c5 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00000002 01800208 60004108 02010700 000c1040 02004064 06088002 00201000 06100100 c00008e0 0d00000c 40058000 00009806 08e00000 113400c1 000c200c 08800008 0200c000 00600000 00020001 c0020080 18008078 21800041 81708010 00042400 c0000000 28008000 00040004 04404200 01460008 400c0000 00000680 |