On Target BACE1_HUMAN 0.40163934/CHEMBL572940
For the given ligand lvkui19001, we have found in our database that, being scored 0.40163934, the most similar ligand is CHEMBL572940. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL572940 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | Fc1ccc(NC(=O)c2ccc3C(=O)Nc4ccccc4Nc3c2)cc1 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 02004022 00801800 00100100 02010600 01040040 00000030 00008000 02001004 06000000 40000860 0c280004 4000c000 80008800 00701000 00140040 00040004 08040008 02004000 08600000 00200000 40100000 08028608 21812040 80500004 00004000 c0000000 00008040 80040081 00008100 00068001 80048000 00000220 |