On Target NEP_HUMAN 0.42857143/CHEMBL213944
For the given ligand lvkui19001, we have found in our database that, being scored 0.42857143, the most similar ligand is CHEMBL213944. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL213944 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CCCC(CC1(CCCC1)C(=O)NC2=CN(Cc3ccccc3)C(=O)C=C2)C(=O)O |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00014002 01800200 00104100 00010620 200c0000 08002050 00000000 00001000 06100000 400208e0 0428000c 40019000 04028838 01f00000 00120081 000c000c 00040000 02004008 08602000 00000005 c0100001 18008e10 2180e000 81700810 00000002 c0100000 00000410 10040080 04000000 01460009 00060000 00000288 |