On Target HPGDS_HUMAN 0.33834586/CHEMBL3425951
For the given ligand lvkui19001, we have found in our database that, being scored 0.33834586, the most similar ligand is CHEMBL3425951. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL3425951 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CN(C)CCC(=O)Nc1cncc(c1)c2cccc3[nH]ccc23 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00006002 00800800 40104100 00010630 24041000 0c000018 00000000 00000000 00000000 40000970 00280004 60009000 89008800 00700000 00020041 80040004 00060000 0200000c 0c200010 00000006 60100000 18028608 30802000 80400018 00040003 80180000 08000640 000000c0 00404000 00460011 00040200 000002a0 |