On Target NK1R_HUMAN 0.3821656/CHEMBL421591
For the given ligand lvkui19001, we have found in our database that, being scored 0.3821656, the most similar ligand is CHEMBL421591. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL421591 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CN(Cc1ccccc1)C(=O)NC2=C(c3ccccc3)c4ccccc4C(=O)N2C |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00002006 00800000 00084100 00010e10 20041000 0400006a 00401004 02083001 06000200 400008e0 0d380124 40118000 00018800 00700000 00120040 80140004 00064040 82406024 0c200000 00e00002 c0000100 9c018418 30826800 80700408 00340009 c0080100 08000290 810010c0 0040c118 01060841 00040800 80004300 |