On Target AA1R_HUMAN 0.36885247/CHEMBL541185
For the given ligand lvkui19001, we have found in our database that, being scored 0.36885247, the most similar ligand is CHEMBL541185. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL541185 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CN1C(=O)N(C)c2c([nH]c3cccnc23)C1=O |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 0000002a 00800000 00004000 02010600 000c0040 0000c060 00008006 00000000 06400100 c00000e0 0d00000c 00018000 00009800 00e00000 003c00c0 000c0004 08800000 00008000 00600000 00000000 c0000080 18008078 21800041 80300000 02040000 c0000000 20008000 00040000 00004000 00460000 400c0200 00000680 |