On Target AOFB_HUMAN 0.37037036/CHEMBL3319245
For the given ligand lvkui19001, we have found in our database that, being scored 0.37037036, the most similar ligand is CHEMBL3319245. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL3319245 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | O=C(Nc1ccccc1)c2ccc3[nH]ncc3c2 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00004002 00008808 20000100 00010600 00040000 00000000 02000000 02001000 00000000 00000840 00280004 4000c000 00008802 00500000 00000040 0004000c 00040000 02000004 08600000 00220200 40100000 0c068608 20812800 00600004 00100000 80000000 00000000 80000080 00008100 00060001 80040000 00004220 |