On Target CNR1_HUMAN 0.41666666/CHEMBL527031
For the given ligand lvkui19001, we have found in our database that, being scored 0.41666666, the most similar ligand is CHEMBL527031. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL527031 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | COc1cccc2c3C(=O)N(C=Cc3n(CCN4CCOCC4)c12)[C@H]5[C@@]6(C)CC[C@H](C6)C5(C)C |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00000002 01800408 60004008 c0000600 000c1090 00000064 0e000000 00200000 06200000 c00008e0 04200004 40058000 00008806 08e00000 013018c9 000c010c 10800000 00004000 02602000 00860001 40000000 38008018 32800040 82308010 0a000440 c0000000 00000000 00040001 08000200 01060010 00060200 00000600 |