On Target NMDE2_HUMAN 0.2932331/CHEMBL218067
For the given ligand lvkui19001, we have found in our database that, being scored 0.2932331, the most similar ligand is CHEMBL218067. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL218067 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | O=C(OCc1ccccc1)N2CCC(CNc3cccnc3)CC2 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 01004002 01c01000 00104100 00010620 20040000 0800e010 00000000 20000000 00200300 000008c0 00200004 50038000 00008802 00010000 00020001 021e000c 00060000 02080408 08200880 00000205 40100000 18048c70 20800000 00500018 00000002 80102002 00000400 10200080 00000200 00460001 c0000000 00000280 |