On Target GRM5_HUMAN 0.37894738/CHEMBL1682800
For the given ligand lvkui19001, we have found in our database that, being scored 0.37894738, the most similar ligand is CHEMBL1682800. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL1682800 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | O=C1NC=Cc2cc(ccc12)C#Cc3ccccc3 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 10000202 00020000 00004900 00090200 00442000 00000060 00000000 00000000 06000000 40000860 04010004 40008000 00008800 00600000 00100040 00040004 00000000 02000000 00200000 00200000 40000000 08808008 20800001 82500000 00000004 c0000000 00000040 00000000 00000000 00020000 00040000 00000000 |