On Target P2RX3_HUMAN 0.30967742/CHEMBL3669705
For the given ligand lvkui19001, we have found in our database that, being scored 0.30967742, the most similar ligand is CHEMBL3669705. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL3669705 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | COc1ccc(cc1)C(=O)C2C(C3CCCCC3)N(C(=O)C2=O)c4ccc5[nH]ccc5c4 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00034002 01801a08 2010010b 00010600 20041000 00002010 02040000 20000000 04100900 000808c0 08380004 5001b000 0e00880a 00700000 81020041 0004000c 00040000 02000009 0a202018 00020205 40100100 18068618 20802000 8050001c 00001800 80000080 00120080 10000080 00008202 0006000b 80065200 00c02600 |