On Target 5HT2A_HUMAN 0.4935065/CHEMBL38633
For the given ligand lvkui19001, we have found in our database that, being scored 0.4935065, the most similar ligand is CHEMBL38633. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL38633 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CN(C)CCn1ccc2ccccc12 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00000002 00000000 00000000 40000600 00040000 00000000 00000000 00000000 00200000 000008c0 00200004 40018000 00000800 00400000 00000840 00040004 00000000 00000000 00200000 00000000 40000000 38008018 20800000 80000000 08000000 00000000 00000000 00000000 08000000 00060010 00040200 00000200 |