On Target P2Y12_HUMAN 0.3/CHEMBL2103828
For the given ligand lvkui19001, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL2103828. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL2103828 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CNc1cc2NC(=O)N(C(=O)c2cc1F)c3ccc(NC(=O)NS(=O)(=O)c4ccc(Cl)s4)cc3 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00018012 00401200 01100a00 02b80e00 000c8260 10004030 0c028002 0000300d 06100140 4000b8e0 0528220c e0218880 02009a04 00721041 903400c0 001c0005 0a042408 0000a000 0ae00080 00406000 40002082 580585b9 21802041 89300208 04140000 e4002000 30008080 000504ad 0400c400 20478009 40040000 00c346e0 |