On Target PRGR_HUMAN 0.40298507/CHEMBL4082878
For the given ligand lvkui19001, we have found in our database that, being scored 0.40298507, the most similar ligand is CHEMBL4082878. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL4082878 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CC(C)(CC(O)(CNc1cccc2C(=O)NC=Cc12)C(F)(F)F)c3cccc(F)c3O |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00004002 01800008 2010510a 02010600 20040080 00002070 02000000 00000200 06100800 400828e0 0c300004 50018040 00028802 00601000 00120040 000c240c 00040800 02000008 08600000 00020005 40100100 18008008 23808040 a0500010 00000000 c0000000 88000060 90000081 00108000 0207c002 00040000 00000600 |