On Target AA2AR_HUMAN 0.56962025/CHEMBL603095
For the given ligand lvkui19001, we have found in our database that, being scored 0.56962025, the most similar ligand is CHEMBL603095. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL603095 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CN1C(=O)C=C2c3ccccc3C(=O)c4c(N)ccc1c24 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00000002 00800000 00004000 00000600 00040000 00000060 00000000 00000000 06000000 c00008e0 04000004 00018000 00008800 00600000 001000c0 00040004 00000000 00000008 00200000 00000000 40000000 18008018 20800000 80300000 02000000 40000000 00000040 00000000 00000000 00060000 00040000 00000000 |