On Target DRD4_HUMAN 0.44761905/CHEMBL4094407
For the given ligand lvkui19001, we have found in our database that, being scored 0.44761905, the most similar ligand is CHEMBL4094407. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL4094407 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CN1CCN(CC1)c2ccc(O)c3NC(=O)C=Cc23 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00004002 00000008 60004020 04000600 00040000 00000064 02008000 00200000 06000000 40000a60 04200004 40008000 00008822 00602000 00100040 0004000c 00040000 00000000 08200000 00420000 40100000 28048008 20800020 82101012 00000400 40000000 00048080 000000a0 08008000 00060000 00040000 00000240 |