On Target PGH2_HUMAN 0.31746033/CHEMBL596692
For the given ligand lvkui19001, we have found in our database that, being scored 0.31746033, the most similar ligand is CHEMBL596692. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL596692 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | OC(=O)Cc1ccc(cc1)C2=CC(=O)N(C=C2)C(F)F |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00002002 00000800 00104100 00110600 00040040 00002040 00000000 00000000 06000100 400808e0 0c000004 60019800 81008800 00200000 40140000 000c020c 08060000 02800000 04280000 10000000 40000000 18028a90 31800000 00700018 00000000 c0000000 00000020 a0000050 01024000 00060002 00002000 00010620 |