On Target GLRA3_HUMAN 0.19138756/CHEMBL4074873
For the given ligand lvkui19001, we have found in our database that, being scored 0.19138756, the most similar ligand is CHEMBL4074873. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL4074873 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CN1C(=O)[C@@H]2CN(C[C@@H]2c3cnccc13)S(=O)(=O)c4ccc5occc5c4 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00020052 22a04600 01184100 01b00610 200c1200 00002050 1201a000 40200200 00604880 004909e0 00382034 60029000 4c008c03 00100981 80e20000 00040006 0004e004 0a000004 00600418 00007e03 e0100100 18248608 20804000 99480018 0a041800 0100000c 08028010 1800108c 04482400 21060a1b 00000080 20812670 |