On Target ACE_HUMAN 0.35114503/CHEMBL2435340
For the given ligand lvkui19001, we have found in our database that, being scored 0.35114503, the most similar ligand is CHEMBL2435340. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL2435340 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | ON1C(=O)C=CC=C1C(=O)NCc2ccc(cc2)c3ccccc3 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00002002 00800800 00804100 10010e00 00040020 00100040 00000840 02003001 06000140 40000860 04290004 40008000 80008802 00300040 00120400 02040114 00022000 02000002 04200000 10200000 c0802000 08038600 30802000 00d0002c 00100000 c0000000 00000048 80400040 00004104 00060001 80440000 80006200 |