On Target OPRD_HUMAN 0.36885247/CHEMBL493621
For the given ligand lvkui19001, we have found in our database that, being scored 0.36885247, the most similar ligand is CHEMBL493621. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL493621 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | C[C@H]1C2Cc3cc4C=CNC(=O)c4cc3[C@@]1(C)CCN2CC5CC5 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00000002 01004200 00104102 00010600 00040020 00000062 00000000 20000001 06000880 400808e0 0c300004 50818000 00008802 01600000 00100060 02040004 00000200 02000004 00202000 00200201 40000100 18208018 20804000 81500010 00000000 c0000001 00000040 10000000 04400002 0006000a 00060000 00002600 |