On Target CNR2_HUMAN 0.44827586/CHEMBL393792
For the given ligand lvkui19001, we have found in our database that, being scored 0.44827586, the most similar ligand is CHEMBL393792. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL393792 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CCCCCN1C=C(NC(=O)C23CC4CC(CC(C4)C2)C3)C(=O)c5ccccc15 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00014002 01800000 00104000 00000620 20040004 08002070 00000000 00000000 02000000 c00008c0 0028000c 40019000 04008808 00700000 000200c1 00040004 04040000 00004008 0a202000 00001007 c0100000 18008618 20806000 80100010 00000002 00100000 00000410 10040080 00008000 00460001 00460000 00000288 |