On Target NTRK1_HUMAN 0.4117647/CHEMBL2380845
For the given ligand lvkui19001, we have found in our database that, being scored 0.4117647, the most similar ligand is CHEMBL2380845. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL2380845 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | O=C(Nc1ccc(Nc2ccnc3NC(=O)c4ccccc4c23)cc1)c5ccccc5 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00004002 00001800 00004100 00090600 00040000 00004060 00008010 02001000 06002100 40000860 05380004 4000c000 00008800 00f00000 00100040 000c0004 00040000 02000000 08200002 00400000 40100000 08068628 20812000 80500004 00000000 c0000000 22008080 800000a0 0000c100 00460001 c0040000 000002c0 |