On Target MTOR_HUMAN 0.5283019/CHEMBL1259137
For the given ligand lvkui19001, we have found in our database that, being scored 0.5283019, the most similar ligand is CHEMBL1259137. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL1259137 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CN(C)CCN1C(=O)C=Cc2cnc3ccc(cc3c12)c4cnc5ccccc5c4 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00002002 00800000 00004100 40010610 000c1000 04000068 00000000 00000000 06200001 400008e0 04200004 40018000 00008800 00e00000 003008c0 80040004 00020000 02000004 04600000 00000002 40000000 38008018 30800040 80700000 0c040001 c0080000 08000200 00000040 08404000 00060050 00040000 00000200 |