On Target FYN_HUMAN 0.40145984/CHEMBL1969502
For the given ligand lvkui19001, we have found in our database that, being scored 0.40145984, the most similar ligand is CHEMBL1969502. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL1969502 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | O=C(Nc1cc2C(=O)NN=Cc3c[nH]c(c1)c23)C4CC4c5ccccc5 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00014002 01000208 20100102 00010600 200c0000 00002060 06008000 00000000 06100800 c00808c0 08380004 40019000 04028806 01f00000 00020040 0005000c 00040000 02000008 08600008 00220405 40100100 1c048608 2080e840 80700018 02102800 80000000 00008080 10000080 00008000 0006000b 00040200 00404640 |