On Target CAH2_HUMAN 0.42990655/CHEMBL2377779
For the given ligand lvkui19001, we have found in our database that, being scored 0.42990655, the most similar ligand is CHEMBL2377779. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL2377779 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | NS(=O)(=O)c1ccc(cc1)N2C(=O)c3cccc4cccc(C2=O)c34 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00000012 00802200 01004000 02b00600 00040010 00000060 00000002 00001000 06100000 400008e0 04002004 20018000 00008800 00600001 80300040 0004000c 00000000 00000000 00200000 00002000 c0000080 18008018 20800000 89700008 00000000 40000000 00400000 00000048 04000000 20060008 00040000 00010220 |