On Target ESR1_HUMAN 0.33571428/CHEMBL1433745
For the given ligand lvkui19001, we have found in our database that, being scored 0.33571428, the most similar ligand is CHEMBL1433745. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL1433745 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | O=C(CCCN1C(=S)Nc2ccccc2C1=O)N3CCN(CC3)c4cccc5ccccc45 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00064012 00002000 00100020 04000600 000c0000 00004060 02000000 20000808 06200100 c00c0ae0 0120000c 40039000 04009002 00e02000 000000c0 000c0004 20040000 01008180 08600020 00010201 c0100000 38000638 21800061 0230001a 00000000 80000000 20000100 10040080 0800c000 00470001 40080000 00010288 |