On Target PTGES_HUMAN 0.4181818/CHEMBL3604190
For the given ligand lvkui19001, we have found in our database that, being scored 0.4181818, the most similar ligand is CHEMBL3604190. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL3604190 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | CCn1c2ccccc2c3cc(NC(=O)c4ccccc4C(F)(F)F)ccc13 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00004002 00800800 00100100 10010600 00040000 00008000 00000400 02001000 00000000 000008d0 00280004 4001c000 00008800 01700000 000000c0 04040004 00040000 02000008 08202000 00000004 44120000 18028618 20812000 80400004 00000000 80000000 00000080 90000080 00008100 00060001 80160220 00000200 |