On Target MIF_HUMAN 0.2733813/CHEMBL523238
For the given ligand lvkui19001, we have found in our database that, being scored 0.2733813, the most similar ligand is CHEMBL523238. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL523238 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | Cc1ccc2OC(=O)N(Cc3ccccc3)c2c1 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00000002 00000a00 00080100 00010600 00040210 00400000 00000400 80001600 04184020 000008f0 04000024 40c1a000 c0008c00 01600100 00100040 00040204 00040000 42804000 00200080 50000000 40000000 1a008010 20800018 a5780000 10000000 c0000000 20000170 18040010 06006000 03060008 00140000 00000020 |