On Target MK03_HUMAN 0.2932331/CHEMBL302449
For the given ligand lvkui19001, we have found in our database that, being scored 0.2932331, the most similar ligand is CHEMBL302449. Check out the elaboration below.
| lvkui19001 (Given Ligand) | CHEMBL302449 (Similar Ligand) |
|---|---|
| C[NH+](C)CCn1c(=O)c3cccc2cc(NC(N)=O)cc(c1=O)c23 | Cn1c2ccccc2c3c4C(=O)NCc4c5c6ccccc6n(CCC#N)c5c13 |
|
|
|
|
|
|
| 00000002 00800000 00004000 42000e00 00040000 00000060 00000000 00002001 06200001 400008e0 04280004 40018000 00028800 00700000 001008c0 0004000c 00040000 00000008 08200000 00000004 40000000 38008418 2080a000 80300000 0c100000 40000000 00000000 00000080 08008000 00060011 00040000 00004200 | 00000002 00809800 00000100 10010700 000c0040 00008000 00008000 02001004 00004000 000008c0 00200004 40018000 80008c02 00e00000 000404c0 00040004 08c02008 02800004 00600000 00000000 c0000000 18068698 21800400 8050001c 00004000 c0200000 00008040 80000000 00400100 000e0041 800c8200 000002a0 |