On Target PERM_HUMAN 0.33333334/CHEMBL490
For the given ligand dd106, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL490. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL490 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | Fc1ccc(cc1)[C@@H]2CCNC[C@H]2COc3ccc4OCOc4c3 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04000001 01000208 20100108 02010700 00081000 02000010 42000000 20000000 00200800 000808c0 48300000 50018000 00804002 01001000 11000001 002ca008 00a00000 02000084 00c80000 00120a01 00040300 18000000 010000c0 00500010 40000001 80000000 00080000 30000001 01050200 0006800a 00000000 02012640 |