On Target ACES_HUMAN 0.5289256/CHEMBL3905695
For the given ligand dd106, we have found in our database that, being scored 0.5289256, the most similar ligand is CHEMBL3905695. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL3905695 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | COc1ccc(\C=C\C(=O)NCCC2CCN(Cc3ccccc3)CC2)cc1 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00000000 01009008 20100108 00010600 00001000 00000000 82140080 22001400 01800000 004008c0 00200000 50018000 00008802 00010000 01000403 00000008 20000400 02000100 00018000 00820201 00000000 18048620 00000001 00500018 00000000 c0000000 004a2000 d0010000 00400300 00060001 24040000 02000200 |