On Target COMT_HUMAN 0.38513514/CHEMBL953
For the given ligand dd106, we have found in our database that, being scored 0.38513514, the most similar ligand is CHEMBL953. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL953 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CCN(CC)C(=O)\C(=C\c1cc(O)c(O)c(c1)[N+](=O)[O-])\C#N |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00000006 c0008018 20100100 00010620 00000004 00080000 82102080 00000400 15800000 00400860 04200004 40129000 00018202 00010000 20100142 0000c018 20400400 02000100 00018000 00820602 40020000 18000600 60000401 00401418 00040000 c0000000 004a2100 4001a000 00480000 000e0101 04000000 0c008280 |