On Target TRPV1_RAT 0.46979865/CHEMBL1276940
For the given ligand dd106, we have found in our database that, being scored 0.46979865, the most similar ligand is CHEMBL1276940. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL1276940 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | COc1cc(CC(=O)NCC(COC(=O)C(C)(C)C)Cc2ccc(cc2)C(C)(C)C)cc(Br)c1OC(=O)C |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04004040 52009208 20100108 01210700 00001000 80000002 02040000 20000001 40000980 000808c0 08300002 c0009800 0180c012 20080001 41010001 020c9008 00220000 02000000 00c80000 00024201 00000120 18340e00 110000c0 81400018 02000421 80000000 00120000 10010004 05000200 0006000f 00002008 18002600 |