On Target SC6A4_HUMAN 0.448/CHEMBL391193
For the given ligand dd106, we have found in our database that, being scored 0.448, the most similar ligand is CHEMBL391193. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL391193 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CN(C)CCC(Oc1ccc(Br)cc1)c2ccc(OCCCN3CCCCC3)cc2 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04004000 01008208 20100108 00010600 00001000 02004000 02040000 20000000 00000900 000808c0 08300000 50018000 00800012 00010000 01000001 020c2008 00200000 02000000 00800000 00020201 00000100 18000020 01008080 00d01010 00000001 80002000 00520000 10000000 00000200 0006000a 40000008 08002640 |