On Target MK01_HUMAN 0.38505748/CHEMBL2002649
For the given ligand dd106, we have found in our database that, being scored 0.38505748, the most similar ligand is CHEMBL2002649. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL2002649 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | COc1ccc2NC(=O)C(=Cc3c[nH]cn3)c2c1 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00004242 42008008 20100108 02010e10 20001045 84000000 82000280 08024408 01800100 00482840 08288104 60109808 01008022 20110002 c1020143 000c000c 20040400 12000100 08090000 40820202 40100000 18200600 21222000 81410011 00040000 82000201 00442011 40011280 04408204 00460103 44002000 20000700 |