On Target TRPV3_HUMAN 0.2777778/CHEMBL3664218
For the given ligand dd106, we have found in our database that, being scored 0.2777778, the most similar ligand is CHEMBL3664218. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL3664218 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | COc1cccc(CNC(=O)CC2CC3(CCC3)Oc4ccc(Cl)cc24)c1OC5CCCC5 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04018000 45800218 2010010a 00210700 00081000 82000100 06000000 22001600 00000800 001808c0 08300000 40019840 0680c82e 01200010 91000601 020ca008 00800000 22008400 00482008 00020201 80000140 18008710 01000040 00548418 00002800 c0000000 00100000 90000000 00000302 0106c00b 24060000 00020640 |