On Target AMPN_HUMAN 0.35714287/CHEMBL3806197
For the given ligand dd106, we have found in our database that, being scored 0.35714287, the most similar ligand is CHEMBL3806197. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL3806197 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | COc1ccc(CCNCC(N)P(=O)(O)O)cc1 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00000400 00000608 20100108 00010620 00001000 00000000 02040000 00000000 00000080 00080840 08200000 40008000 00000002 00020000 01000001 00000008 00000028 02000000 40000000 00020200 00000000 3d300000 00800001 83400010 00002002 80000000 00120000 00014000 0c080200 00060002 20800000 00008623 |