On Target PPARG_HUMAN 0.6/CHEMBL3355872
For the given ligand dd106, we have found in our database that, being scored 0.6, the most similar ligand is CHEMBL3355872. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL3355872 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | OC(=O)C(Cc1ccc(OCCOc2ccc(\C=C\c3ccccc3)cc2)cc1)NC(=O)\C=C\c4ccccc4 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04000000 0000d008 20100108 00010600 00001080 00000000 82140080 00000404 01802880 00480840 08300900 c000b000 06808002 00010000 01200003 00080008 30000400 02000100 0041800a 00820201 00000100 18200e00 07000041 89400018 00000800 80000000 005a2000 40810000 04400200 00060003 24004000 02000600 |