On Target ACM4_HUMAN 0.41666666/CHEMBL83
For the given ligand dd106, we have found in our database that, being scored 0.41666666, the most similar ligand is CHEMBL83. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL83 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CC\C(=C(/c1ccccc1)\c2ccc(OCCN(C)C)cc2)\c3ccccc3 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04002000 00000008 20000308 00010602 00001080 00000000 82040080 01000400 00000800 00180840 08300100 40008000 00800002 00000000 01001003 00080008 00000400 02000000 00000000 00020001 00000100 18040000 12008001 00400010 01000000 a0000000 00522000 40000000 00400280 00060002 04000000 00000600 |