On Target TNFA_HUMAN 0.36/CHEMBL72511
For the given ligand dd106, we have found in our database that, being scored 0.36, the most similar ligand is CHEMBL72511. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL72511 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CNC(=O)[C@@H](NC(=O)[C@@H]([C@H](CO)C(=O)NO)c1ccc(OC)cc1)C(C)(C)C |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00060000 00003218 60100108 04010600 00101000 00000000 0a040000 20000008 00200880 000808c0 08300000 4002b000 17008016 00002000 c1000001 00080018 00000000 02000000 00c00008 00060201 00000100 38200600 01000041 83400018 00002800 80000000 00120000 10000000 0c000202 0006000f 20006000 02802e00 |