On Target HPGDS_HUMAN 0.26666668/CHEMBL3698263
For the given ligand dd106, we have found in our database that, being scored 0.26666668, the most similar ligand is CHEMBL3698263. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL3698263 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CC1C=CC=C1C(=O)N2CCN(CC2)C(=O)NC3CCN(CC3)c4ccc(CCn5ccnn5)cc4 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00004002 0104be18 60100100 44010e00 60080000 00002001 04100004 20002408 11100000 101a09e0 08240004 50019800 0402b006 2081a000 00020240 000c000c 20044010 02000100 084900c0 02041201 60120100 38090600 61009061 83500818 00212000 80000000 00480000 90000080 0c008000 800e001b 04100000 04008600 |