On Target NOS1_HUMAN 0.29220778/CHEMBL4099944
For the given ligand dd106, we have found in our database that, being scored 0.29220778, the most similar ligand is CHEMBL4099944. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL4099944 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CNCCc1cc(OCc2ccc3c(C)cc(N)nc3c2)cc(c1)C#N |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04000002 42000808 20104108 00010600 00041025 8000c000 02000000 00000000 00400100 00880840 08200004 40008000 80800802 20410080 01000041 020c000c 00400001 02000004 00a80000 00220200 40000000 1c208028 20800c80 81e01010 00040000 80002000 002000c0 00000000 04000208 00060402 40040000 00000620 |