On Target NMDE2_HUMAN 0.35384616/CHEMBL48029
For the given ligand dd106, we have found in our database that, being scored 0.35384616, the most similar ligand is CHEMBL48029. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL48029 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | C(Cc1ccc(OCc2ccccc2)cc1)Nc3ccncc3 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04000002 00000008 20104108 00010600 20041000 00004000 02048000 00000000 00000100 00080840 08200004 40008000 00800802 00010000 01020001 020c000c 00040000 02000000 00200000 00020000 40100000 18248020 20800000 81c01011 00000000 80002000 00128000 00000080 04000200 00060002 40000000 00000640 |