On Target GRM5_HUMAN 0.31851852/CHEMBL2151818
For the given ligand dd106, we have found in our database that, being scored 0.31851852, the most similar ligand is CHEMBL2151818. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL2151818 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | C[C@@H](NC(=O)c1ccc(OCc2cccc(F)c2)cc1)C(C)(C)C |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04000000 00401808 20100109 02010600 00001000 00004010 02040000 02001000 00000100 00002840 00200000 50008000 00808802 00011000 01000401 02080008 00000000 02000000 00000000 00020201 00000000 18028620 00000000 00c0101c 00000000 c0002002 00220000 80000001 00000300 00068001 e0040000 00000200 |